Products 2126177-83-9
CAS 2126177-83-9 is the registry number for 5-{(2-(Diethylamino)ethyl)amino}-2-nitrobenzamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-[2-(diethylamino)ethylamino]-2-nitrobenzamide (CAS 2126177-83-9) is a chemical compound with the molecular formula C13H20N4O3 and a molecular weight of 280.32 g/mol. IUPAC name: 5-[2-(diethylamino)ethylamino]-2-nitrobenzamide. InChIKey: HJGYKQCZIBUMSS-UHFFFAOYSA-N.
| Molecular formula | C13H20N4O3 |
|---|---|
| Molecular weight | 280.32 g/mol |
| IUPAC name | 5-[2-(diethylamino)ethylamino]-2-nitrobenzamide |
| InChIKey | HJGYKQCZIBUMSS-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCNC1=CC(=C(C=C1)[N+](=O)[O-])C(=O)N |
Computed by PubChem (NCBI)