CAS 2129565-13-3 is the registry number for N-(Carboxymethyl)-D-Cysteine. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-(carboxymethylamino)-3-sulfanylpropanoic acid (CAS 2129565-13-3) is a chemical compound with the molecular formula C5H9NO4S and a molecular weight of 179.20 g/mol. IUPAC name: (2S)-2-(carboxymethylamino)-3-sulfanylpropanoic acid. InChIKey: VUCDIRJQEQYQRN-GSVOUGTGSA-N.
| Molecular formula | C5H9NO4S |
|---|---|
| Molecular weight | 179.20 g/mol |
| IUPAC name | (2S)-2-(carboxymethylamino)-3-sulfanylpropanoic acid |
| InChIKey | VUCDIRJQEQYQRN-GSVOUGTGSA-N |
| SMILES | C([C@H](C(=O)O)NCC(=O)O)S |
Computed by PubChem (NCBI)