Products 21301-10-0

CAS 21301-10-0 is the registry number for Tiopronin Impurity 7. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(carboxymethylamino)-3-sulfanylpropanoic acid (CAS 21301-10-0) is a chemical compound with the molecular formula C5H9NO4S and a molecular weight of 179.20 g/mol. IUPAC name: 2-(carboxymethylamino)-3-sulfanylpropanoic acid. InChIKey: VUCDIRJQEQYQRN-UHFFFAOYSA-N.

Identity
Molecular formulaC5H9NO4S
Molecular weight179.20 g/mol
IUPAC name2-(carboxymethylamino)-3-sulfanylpropanoic acid
InChIKeyVUCDIRJQEQYQRN-UHFFFAOYSA-N
SMILESC(C(C(=O)O)NCC(=O)O)S

Computed by PubChem (NCBI)