Products 63459-24-5

CAS 63459-24-5 is the registry number for 2-(1,1-Dioxo-1,2-thiazolidin-2-yl)acetic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 10g, 1g.

Structural formula: {0} (CAS {1})

2-(1,1-dioxo-1,2-thiazolidin-2-yl)acetic acid (CAS 63459-24-5) is a chemical compound with the molecular formula C5H9NO4S and a molecular weight of 179.20 g/mol. IUPAC name: 2-(1,1-dioxo-1,2-thiazolidin-2-yl)acetic acid. InChIKey: NLZVKANCYYRWBB-UHFFFAOYSA-N.

Identity
Molecular formulaC5H9NO4S
Molecular weight179.20 g/mol
IUPAC name2-(1,1-dioxo-1,2-thiazolidin-2-yl)acetic acid
InChIKeyNLZVKANCYYRWBB-UHFFFAOYSA-N
SMILESC1CN(S(=O)(=O)C1)CC(=O)O

Computed by PubChem (NCBI)