Products 50698-76-5
CAS 50698-76-5 appears in our catalog under these names: Carbocisteine Impurity B, (S)-Carbocisteine, Carbocisteine Impurity 3（Carbocisteine S-Isomer）. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(2S)-2-amino-3-(carboxymethylsulfanyl)propanoic acid (CAS 50698-76-5) is a chemical compound with the molecular formula C5H9NO4S and a molecular weight of 179.20 g/mol. IUPAC name: (2S)-2-amino-3-(carboxymethylsulfanyl)propanoic acid. InChIKey: GBFLZEXEOZUWRN-GSVOUGTGSA-N.
| Molecular formula | C5H9NO4S |
|---|---|
| Molecular weight | 179.20 g/mol |
| IUPAC name | (2S)-2-amino-3-(carboxymethylsulfanyl)propanoic acid |
| InChIKey | GBFLZEXEOZUWRN-GSVOUGTGSA-N |
| SMILES | C([C@H](C(=O)O)N)SCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
S-(Carboxymethyl)-D-cysteine, Carbocysteine, D-, D-Cysteine, S-(carboxymethyl)-, (2S)-2-amino-3-(carboxymethylsulfanyl)propanoic acid, (S)-2-amino-3-((carboxymethyl)thio)propanoic acid, S-carboxymethyl-D-cysteine, Carbocisteine S-Isomer, D-carbocysteine, Carbocysteine impurity B, Carbocisteine Impurity B