Products 2130-56-5
CAS 2130-56-5 appears in our catalog under these names: 3,3'-Dicarboxybenzidine, 4,4'-Diamino-[1,1'-biphenyl]-3,3'-dicarboxylic acid, 97%, 4,4'-Diamino-[1,1'-biphenyl]-3,3'-dicarboxylic acid, 98%, 3,3′-Dicarboxy-4,4′-diaminobiphenyl, 98%. Offered by: Biosynth, BLDpharm, Fluorochem, Chemat. Available pack sizes: 5g, 2g, 10g, 25g, 50g, 100mg, 250mg, 1g.
2-amino-5-(4-amino-3-carboxyphenyl)benzoic acid (CAS 2130-56-5) is a chemical compound with the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. IUPAC name: 2-amino-5-(4-amino-3-carboxyphenyl)benzoic acid. InChIKey: IIQLVLWFQUUZII-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O4 |
|---|---|
| Molecular weight | 272.26 g/mol |
| IUPAC name | 2-amino-5-(4-amino-3-carboxyphenyl)benzoic acid |
| InChIKey | IIQLVLWFQUUZII-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CC(=C(C=C2)N)C(=O)O)C(=O)O)N |
Computed by PubChem (NCBI)
Synonyms:
Benzidine-3,3'-dicarboxylic acid, 4,4'-diaminobiphenyl-3,3'-dicarboxylic acid, 5,5'-Bianthranilic acid, 5,5'-Dianthranilic acid, 3,3'-Benzidinedicarboxylic acid, Benzidine-M,M'-dicarboxylic acid, 3,3'-dicarboxy-4,4'-diaminobiphenyl, 4,4'-Diamino-3,3'-biphenyldicarboxylic acid, Kwas benzydynodwukaroksylowy [Polish], 3,3'-Biphenyldicarboxylic acid, 4,4'-diamino-