Products 21309-72-8
CAS 21309-72-8 is the registry number for 2-(Benzo[d]isothiazol-3-ylamino)ethanol, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-(1,2-benzothiazol-3-ylamino)ethanol (CAS 21309-72-8) is a chemical compound with the molecular formula C9H10N2OS and a molecular weight of 194.26 g/mol. IUPAC name: 2-(1,2-benzothiazol-3-ylamino)ethanol. InChIKey: QVPIUTQGLNCIBL-UHFFFAOYSA-N.
| Molecular formula | C9H10N2OS |
|---|---|
| Molecular weight | 194.26 g/mol |
| IUPAC name | 2-(1,2-benzothiazol-3-ylamino)ethanol |
| InChIKey | QVPIUTQGLNCIBL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NS2)NCCO |
Computed by PubChem (NCBI)