CAS 2133859-97-7 is the registry number for tert-Butyl ((1S,3S,4S)-3-benzyl-4-hydroxycyclopentyl)carbamate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(1S,3S,4S)-3-benzyl-4-hydroxycyclopentyl]carbamate (CAS 2133859-97-7) is a chemical compound with the molecular formula C17H25NO3 and a molecular weight of 291.4 g/mol. IUPAC name: tert-butyl N-[(1S,3S,4S)-3-benzyl-4-hydroxycyclopentyl]carbamate. InChIKey: SUQMELJPVWLGSX-KKUMJFAQSA-N.
| Molecular formula | C17H25NO3 |
|---|---|
| Molecular weight | 291.4 g/mol |
| IUPAC name | tert-butyl N-[(1S,3S,4S)-3-benzyl-4-hydroxycyclopentyl]carbamate |
| InChIKey | SUQMELJPVWLGSX-KKUMJFAQSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1C[C@@H]([C@H](C1)O)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)