CAS 2134097-34-8 appears in our catalog under these names: trans-Amorolfine, Amorolfine Impurity 5(Amorolfine EP Impurity E). Offered by: TRC, Hubei YoungXin. Available pack sizes: 10mg, 50mg, 25mg, 100mg, 200mg.
(2S,6S)-2,6-dimethyl-4-[2-methyl-3-[4-(2-methylbutan-2-yl)phenyl]propyl]morpholine (CAS 2134097-34-8) is a chemical compound with the molecular formula C21H35NO and a molecular weight of 317.5 g/mol. IUPAC name: (2S,6S)-2,6-dimethyl-4-[2-methyl-3-[4-(2-methylbutan-2-yl)phenyl]propyl]morpholine. InChIKey: MQHLMHIZUIDKOO-FQECFTEESA-N.
| Molecular formula | C21H35NO |
|---|---|
| Molecular weight | 317.5 g/mol |
| IUPAC name | (2S,6S)-2,6-dimethyl-4-[2-methyl-3-[4-(2-methylbutan-2-yl)phenyl]propyl]morpholine |
| InChIKey | MQHLMHIZUIDKOO-FQECFTEESA-N |
| SMILES | CCC(C)(C)C1=CC=C(C=C1)CC(C)CN2C[C@@H](O[C@H](C2)C)C |
Computed by PubChem (NCBI)