CAS 2714893-32-8 is the registry number for meta-Amorolfine. Offered by: TRC. Available pack sizes: 100mg.
(2R,6S)-2,6-dimethyl-4-[2-methyl-3-[3-(2-methylbutan-2-yl)phenyl]propyl]morpholine (CAS 2714893-32-8) is a chemical compound with the molecular formula C21H35NO and a molecular weight of 317.5 g/mol. IUPAC name: (2R,6S)-2,6-dimethyl-4-[2-methyl-3-[3-(2-methylbutan-2-yl)phenyl]propyl]morpholine. InChIKey: GRIBGNAQPXRQMB-AYHJJNSGSA-N.
| Molecular formula | C21H35NO |
|---|---|
| Molecular weight | 317.5 g/mol |
| IUPAC name | (2R,6S)-2,6-dimethyl-4-[2-methyl-3-[3-(2-methylbutan-2-yl)phenyl]propyl]morpholine |
| InChIKey | GRIBGNAQPXRQMB-AYHJJNSGSA-N |
| SMILES | CCC(C)(C)C1=CC=CC(=C1)CC(C)CN2C[C@H](O[C@H](C2)C)C |
Computed by PubChem (NCBI)