CAS 67468-13-7 appears in our catalog under these names: Amorolfine Impurity 18, 1-Desmethyl-2-methylpropyl Amorolfine, Amorolfine Impurity 9(Amorolfine EP Impurity I). Offered by: Chemat Brand, TRC, Hubei YoungXin. Available pack sizes: on request, 10mg, 1mg, 25mg, 50mg, 100mg, 200mg.
(2S,6R)-2,6-dimethyl-4-[2-methyl-3-[4-(3-methylbutan-2-yl)phenyl]propyl]morpholine (CAS 67468-13-7) is a chemical compound with the molecular formula C21H35NO and a molecular weight of 317.5 g/mol. IUPAC name: (2S,6R)-2,6-dimethyl-4-[2-methyl-3-[4-(3-methylbutan-2-yl)phenyl]propyl]morpholine. InChIKey: FVSQRXVLXYEZIE-FXSDRFNOSA-N.
| Molecular formula | C21H35NO |
|---|---|
| Molecular weight | 317.5 g/mol |
| IUPAC name | (2S,6R)-2,6-dimethyl-4-[2-methyl-3-[4-(3-methylbutan-2-yl)phenyl]propyl]morpholine |
| InChIKey | FVSQRXVLXYEZIE-FXSDRFNOSA-N |
| SMILES | C[C@@H]1CN(C[C@@H](O1)C)CC(C)CC2=CC=C(C=C2)C(C)C(C)C |
Computed by PubChem (NCBI)