Products 2134632-91-8
CAS 2134632-91-8 is the registry number for trans-1-Boc-azetidine-2,4-dicarboxylic Acid, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(2S,4S)-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-2,4-dicarboxylic acid (CAS 2134632-91-8) is a chemical compound with the molecular formula C10H15NO6 and a molecular weight of 245.23 g/mol. IUPAC name: (2S,4S)-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-2,4-dicarboxylic acid. InChIKey: BFOGWYCWALBEPH-WDSKDSINSA-N.
| Molecular formula | C10H15NO6 |
|---|---|
| Molecular weight | 245.23 g/mol |
| IUPAC name | (2S,4S)-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-2,4-dicarboxylic acid |
| InChIKey | BFOGWYCWALBEPH-WDSKDSINSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@@H](C[C@H]1C(=O)O)C(=O)O |
Computed by PubChem (NCBI)