Products 213478-57-0

CAS 213478-57-0 is the registry number for Ethyl 2,2-diethoxycyclobutanecarboxylate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl 2,2-diethoxycyclobutane-1-carboxylate (CAS 213478-57-0) is a chemical compound with the molecular formula C11H20O4 and a molecular weight of 216.27 g/mol. IUPAC name: ethyl 2,2-diethoxycyclobutane-1-carboxylate. InChIKey: ATVPTIUILKDJEY-UHFFFAOYSA-N.

Identity
Molecular formulaC11H20O4
Molecular weight216.27 g/mol
IUPAC nameethyl 2,2-diethoxycyclobutane-1-carboxylate
InChIKeyATVPTIUILKDJEY-UHFFFAOYSA-N
SMILESCCOC(=O)C1CCC1(OCC)OCC

Computed by PubChem (NCBI)