Products 213682-41-8
CAS 213682-41-8 is the registry number for (1S,2S,5R)-6,6-difluoro-4-oxo-3-azabicyclo[3.1.0]hexane-2-carboxylic acid. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
(1S,2S,5R)-6,6-difluoro-4-oxo-3-azabicyclo[3.1.0]hexane-2-carboxylic acid (CAS 213682-41-8) is a chemical compound with the molecular formula C6H5F2NO3 and a molecular weight of 177.11 g/mol. IUPAC name: (1S,2S,5R)-6,6-difluoro-4-oxo-3-azabicyclo[3.1.0]hexane-2-carboxylic acid. InChIKey: NZPUZCGQCYAGLV-MGGFGJSXSA-N.
| Molecular formula | C6H5F2NO3 |
|---|---|
| Molecular weight | 177.11 g/mol |
| IUPAC name | (1S,2S,5R)-6,6-difluoro-4-oxo-3-azabicyclo[3.1.0]hexane-2-carboxylic acid |
| InChIKey | NZPUZCGQCYAGLV-MGGFGJSXSA-N |
| SMILES | [C@@H]12[C@@H](C1(F)F)C(=O)N[C@@H]2C(=O)O |
Computed by PubChem (NCBI)