CAS 2137061-77-7 is the registry number for 2-(rac-(3S,4R)-4-(2-Hydroxyethyl)pyrrolidin-3-yl)ethan-1-ol hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[(3R,4S)-4-(2-hydroxyethyl)pyrrolidin-3-yl]ethanol;hydrochloride (CAS 2137061-77-7) is a chemical compound with the molecular formula C8H18ClNO2 and a molecular weight of 195.69 g/mol. IUPAC name: 2-[(3R,4S)-4-(2-hydroxyethyl)pyrrolidin-3-yl]ethanol;hydrochloride. InChIKey: QGXKKNFBAVENRN-KVZVIFLMSA-N.
| Molecular formula | C8H18ClNO2 |
|---|---|
| Molecular weight | 195.69 g/mol |
| IUPAC name | 2-[(3R,4S)-4-(2-hydroxyethyl)pyrrolidin-3-yl]ethanol;hydrochloride |
| InChIKey | QGXKKNFBAVENRN-KVZVIFLMSA-N |
| SMILES | C1[C@@H]([C@@H](CN1)CCO)CCO.Cl |
Computed by PubChem (NCBI)