CAS 2137090-35-6 is the registry number for (8aR)-2-Benzyl-octahydropyrrolo(1,2-a)piperazine-1,4,7-trione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(8aR)-2-benzyl-3,6,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-1,4,7-trione (CAS 2137090-35-6) is a chemical compound with the molecular formula C14H14N2O3 and a molecular weight of 258.27 g/mol. IUPAC name: (8aR)-2-benzyl-3,6,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-1,4,7-trione. InChIKey: VKSDUEUIONRUIC-GFCCVEGCSA-N.
| Molecular formula | C14H14N2O3 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | (8aR)-2-benzyl-3,6,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-1,4,7-trione |
| InChIKey | VKSDUEUIONRUIC-GFCCVEGCSA-N |
| SMILES | C1[C@@H]2C(=O)N(CC(=O)N2CC1=O)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)