CAS 2137447-97-1 appears in our catalog under these names: 4-(((9H-Fluoren-9-yl)methoxy)carbonyl)thiomorpholine-3-carboxylic acid 1,1-dioxide, 98%, 4-{((9H-Fluoren-9-yl)methoxy)carbonyl}thiomorpholine-3-carboxylic acid 1,1-dioxide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 50mg.
4-(9H-fluoren-9-ylmethoxycarbonyl)-1,1-dioxo-1,4-thiazinane-3-carboxylic acid (CAS 2137447-97-1) is a chemical compound with the molecular formula C20H19NO6S and a molecular weight of 401.4 g/mol. IUPAC name: 4-(9H-fluoren-9-ylmethoxycarbonyl)-1,1-dioxo-1,4-thiazinane-3-carboxylic acid. InChIKey: XTWXTTZLOJBEDT-UHFFFAOYSA-N.
| Molecular formula | C20H19NO6S |
|---|---|
| Molecular weight | 401.4 g/mol |
| IUPAC name | 4-(9H-fluoren-9-ylmethoxycarbonyl)-1,1-dioxo-1,4-thiazinane-3-carboxylic acid |
| InChIKey | XTWXTTZLOJBEDT-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC(N1C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)