Products 2138514-95-9
CAS 2138514-95-9 is the registry number for 4-{((9H-Fluoren-9-yl)methoxy)carbonyl}thiomorpholine-2-carboxylic acid 1,1-dioxide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(9H-fluoren-9-ylmethoxycarbonyl)-1,1-dioxo-1,4-thiazinane-2-carboxylic acid (CAS 2138514-95-9) is a chemical compound with the molecular formula C20H19NO6S and a molecular weight of 401.4 g/mol. IUPAC name: 4-(9H-fluoren-9-ylmethoxycarbonyl)-1,1-dioxo-1,4-thiazinane-2-carboxylic acid. InChIKey: RVUOKPXLZZZISL-UHFFFAOYSA-N.
| Molecular formula | C20H19NO6S |
|---|---|
| Molecular weight | 401.4 g/mol |
| IUPAC name | 4-(9H-fluoren-9-ylmethoxycarbonyl)-1,1-dioxo-1,4-thiazinane-2-carboxylic acid |
| InChIKey | RVUOKPXLZZZISL-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)C(CN1C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)