CAS 2248261-08-5 is the registry number for 4-({((9H-Fluoren-9-yl)methoxy)carbonyl}amino)-1,1-dioxo-1λ6-thiolane-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-(9H-fluoren-9-ylmethoxycarbonylamino)-1,1-dioxothiolane-2-carboxylic acid (CAS 2248261-08-5) is a chemical compound with the molecular formula C20H19NO6S and a molecular weight of 401.4 g/mol. IUPAC name: 4-(9H-fluoren-9-ylmethoxycarbonylamino)-1,1-dioxothiolane-2-carboxylic acid. InChIKey: RJLBBBAOKMVKOT-UHFFFAOYSA-N.
| Molecular formula | C20H19NO6S |
|---|---|
| Molecular weight | 401.4 g/mol |
| IUPAC name | 4-(9H-fluoren-9-ylmethoxycarbonylamino)-1,1-dioxothiolane-2-carboxylic acid |
| InChIKey | RJLBBBAOKMVKOT-UHFFFAOYSA-N |
| SMILES | C1C(CS(=O)(=O)C1C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)