Products 79528-50-0
CAS 79528-50-0 is the registry number for Phenyl 2-deoxy-2-phthalimido-b-D-thioglucopyranoside. Offered by: Biosynth. Available pack sizes: 2g, 1g, 5g.
2-[4,5-dihydroxy-6-(hydroxymethyl)-2-phenylsulfanyloxan-3-yl]isoindole-1,3-dione (CAS 79528-50-0) is a chemical compound with the molecular formula C20H19NO6S and a molecular weight of 401.4 g/mol. IUPAC name: 2-[4,5-dihydroxy-6-(hydroxymethyl)-2-phenylsulfanyloxan-3-yl]isoindole-1,3-dione. InChIKey: HLTWBWIHWDQQFB-UHFFFAOYSA-N.
| Molecular formula | C20H19NO6S |
|---|---|
| Molecular weight | 401.4 g/mol |
| IUPAC name | 2-[4,5-dihydroxy-6-(hydroxymethyl)-2-phenylsulfanyloxan-3-yl]isoindole-1,3-dione |
| InChIKey | HLTWBWIHWDQQFB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)SC2C(C(C(C(O2)CO)O)O)N3C(=O)C4=CC=CC=C4C3=O |
Computed by PubChem (NCBI)