Products 2137590-74-8
CAS 2137590-74-8 is the registry number for 2-(2-Aminopropan-2-yl)-5-methoxy-3,4-dihydropyrimidin-4-one hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(2-aminopropan-2-yl)-5-methoxy-1H-pyrimidin-6-one;hydrochloride (CAS 2137590-74-8) is a chemical compound with the molecular formula C8H14ClN3O2 and a molecular weight of 219.67 g/mol. IUPAC name: 2-(2-aminopropan-2-yl)-5-methoxy-1H-pyrimidin-6-one;hydrochloride. InChIKey: PFAWZTPUYUBGNH-UHFFFAOYSA-N.
| Molecular formula | C8H14ClN3O2 |
|---|---|
| Molecular weight | 219.67 g/mol |
| IUPAC name | 2-(2-aminopropan-2-yl)-5-methoxy-1H-pyrimidin-6-one;hydrochloride |
| InChIKey | PFAWZTPUYUBGNH-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=NC=C(C(=O)N1)OC)N.Cl |
Computed by PubChem (NCBI)