Products 2137606-35-8
CAS 2137606-35-8 is the registry number for Methyl 3-amino-3-(4-(trifluoromethyl)phenyl)propanoate hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Methyl 3-amino-3-[4-(trifluoromethyl)phenyl]propanoate;hydrochloride (CAS 2137606-35-8) is a chemical compound with the molecular formula C11H13ClF3NO2 and a molecular weight of 283.67 g/mol. IUPAC name: methyl 3-amino-3-[4-(trifluoromethyl)phenyl]propanoate;hydrochloride. InChIKey: YYHSKEJSOBUGNR-UHFFFAOYSA-N.
| Molecular formula | C11H13ClF3NO2 |
|---|---|
| Molecular weight | 283.67 g/mol |
| IUPAC name | methyl 3-amino-3-[4-(trifluoromethyl)phenyl]propanoate;hydrochloride |
| InChIKey | YYHSKEJSOBUGNR-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(C1=CC=C(C=C1)C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)