Products 2137740-05-5
CAS 2137740-05-5 is the registry number for 5-Amino-3-tert-butyl-1,2-thiazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-amino-3-tert-butyl-1,2-thiazole-4-carboxylic acid (CAS 2137740-05-5) is a chemical compound with the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. IUPAC name: 5-amino-3-tert-butyl-1,2-thiazole-4-carboxylic acid. InChIKey: SIQRVOAVXHNONS-UHFFFAOYSA-N.
| Molecular formula | C8H12N2O2S |
|---|---|
| Molecular weight | 200.26 g/mol |
| IUPAC name | 5-amino-3-tert-butyl-1,2-thiazole-4-carboxylic acid |
| InChIKey | SIQRVOAVXHNONS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NSC(=C1C(=O)O)N |
Computed by PubChem (NCBI)