Products 2137744-01-3
CAS 2137744-01-3 is the registry number for 2-({((9H-Fluoren-9-yl)methoxy)carbonyl}amino)-2,3-dihydro-1H-indene-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(9H-fluoren-9-ylmethoxycarbonylamino)-2,3-dihydro-1H-indene-5-carboxylic acid (CAS 2137744-01-3) is a chemical compound with the molecular formula C25H21NO4 and a molecular weight of 399.4 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-2,3-dihydro-1H-indene-5-carboxylic acid. InChIKey: DWLVTLOPSTYFRV-UHFFFAOYSA-N.
| Molecular formula | C25H21NO4 |
|---|---|
| Molecular weight | 399.4 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-2,3-dihydro-1H-indene-5-carboxylic acid |
| InChIKey | DWLVTLOPSTYFRV-UHFFFAOYSA-N |
| SMILES | C1C(CC2=C1C=CC(=C2)C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)