Products 2137750-67-3

CAS 2137750-67-3 appears in our catalog under these names: Spiro(2.2)pentan-1-ylmethanesulfonyl chloride, 98%, {Spiro(2.2)pentan-1-yl}methanesulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Spiro[2.2]pentan-2-ylmethanesulfonyl chloride (CAS 2137750-67-3) is a chemical compound with the molecular formula C6H9ClO2S and a molecular weight of 180.65 g/mol. IUPAC name: spiro[2.2]pentan-2-ylmethanesulfonyl chloride. InChIKey: AJJLJIWWWHHDNQ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H9ClO2S
Molecular weight180.65 g/mol
IUPAC namespiro[2.2]pentan-2-ylmethanesulfonyl chloride
InChIKeyAJJLJIWWWHHDNQ-UHFFFAOYSA-N
SMILESC1CC12CC2CS(=O)(=O)Cl

Computed by PubChem (NCBI)