Products 923032-59-1

CAS 923032-59-1 appears in our catalog under these names: 1-Allylcyclopropane-1-sulfonyl Chloride, 1–Allylcyclopropane–1–sulfonyl Chloride, 1-Allylcyclopropane-1-sulfonyl chloride, 97%, 1-Allylcyclopropane-1-sulfonyl chloride 97%. Offered by: TRC, GLPBio, Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 100mg, 25mg, 50mg, 1g, 25g, 5g, 10g, 250mg.

Structural formula: {0} (CAS {1})

1-prop-2-enylcyclopropane-1-sulfonyl chloride (CAS 923032-59-1) is a chemical compound with the molecular formula C6H9ClO2S and a molecular weight of 180.65 g/mol. IUPAC name: 1-prop-2-enylcyclopropane-1-sulfonyl chloride. InChIKey: AQYNREAFYINZPS-UHFFFAOYSA-N.

Identity
Molecular formulaC6H9ClO2S
Molecular weight180.65 g/mol
IUPAC name1-prop-2-enylcyclopropane-1-sulfonyl chloride
InChIKeyAQYNREAFYINZPS-UHFFFAOYSA-N
SMILESC=CCC1(CC1)S(=O)(=O)Cl

Computed by PubChem (NCBI)