Products 64805-64-7

CAS 64805-64-7 is the registry number for Milnacipran Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

S-(3-chloro-2-methyl-3-oxopropyl) ethanethioate (CAS 64805-64-7) is a chemical compound with the molecular formula C6H9ClO2S and a molecular weight of 180.65 g/mol. IUPAC name: S-(3-chloro-2-methyl-3-oxopropyl) ethanethioate. InChIKey: LUDPWTHDXSOXDX-UHFFFAOYSA-N.

Identity
Molecular formulaC6H9ClO2S
Molecular weight180.65 g/mol
IUPAC nameS-(3-chloro-2-methyl-3-oxopropyl) ethanethioate
InChIKeyLUDPWTHDXSOXDX-UHFFFAOYSA-N
SMILESCC(CSC(=O)C)C(=O)Cl

Computed by PubChem (NCBI)