Products 2416237-24-4

CAS 2416237-24-4 is the registry number for Bicyclo(2.1.1)hexane-2-sulfonyl chloride, 98%. Offered by: AmBeed. Available pack sizes: 100mg, 250mg, 1g.

Bicyclo[2.1.1]hexane-2-sulfonyl chloride (CAS 2416237-24-4) is a chemical compound with the molecular formula C6H9ClO2S and a molecular weight of 180.65 g/mol. IUPAC name: bicyclo[2.1.1]hexane-2-sulfonyl chloride. InChIKey: NSVRJCUKHBAVQD-UHFFFAOYSA-N.

Identity
Molecular formulaC6H9ClO2S
Molecular weight180.65 g/mol
IUPAC namebicyclo[2.1.1]hexane-2-sulfonyl chloride
InChIKeyNSVRJCUKHBAVQD-UHFFFAOYSA-N
SMILESC1C2CC1C(C2)S(=O)(=O)Cl

Computed by PubChem (NCBI)