Products 2137758-06-4
CAS 2137758-06-4 is the registry number for rac-(1R,2S)-1-Amino-1,2,3,4-tetrahydronaphthalen-2-ol hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(1S,2R)-1-amino-1,2,3,4-tetrahydronaphthalen-2-ol;hydrochloride (CAS 2137758-06-4) is a chemical compound with the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. IUPAC name: (1S,2R)-1-amino-1,2,3,4-tetrahydronaphthalen-2-ol;hydrochloride. InChIKey: SNRPNRYBBYUHMG-UXQCFNEQSA-N.
| Molecular formula | C10H14ClNO |
|---|---|
| Molecular weight | 199.68 g/mol |
| IUPAC name | (1S,2R)-1-amino-1,2,3,4-tetrahydronaphthalen-2-ol;hydrochloride |
| InChIKey | SNRPNRYBBYUHMG-UXQCFNEQSA-N |
| SMILES | C1CC2=CC=CC=C2[C@@H]([C@@H]1O)N.Cl |
Computed by PubChem (NCBI)