Products 2137814-09-4
CAS 2137814-09-4 is the registry number for tert-Butyl N-(3-amino-2,2,4,4-tetramethylcyclobutyl)carbamate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl N-(3-amino-2,2,4,4-tetramethylcyclobutyl)carbamate;hydrochloride (CAS 2137814-09-4) is a chemical compound with the molecular formula C13H27ClN2O2 and a molecular weight of 278.82 g/mol. IUPAC name: tert-butyl N-(3-amino-2,2,4,4-tetramethylcyclobutyl)carbamate;hydrochloride. InChIKey: XXMUGWXZBCRCDV-UHFFFAOYSA-N.
| Molecular formula | C13H27ClN2O2 |
|---|---|
| Molecular weight | 278.82 g/mol |
| IUPAC name | tert-butyl N-(3-amino-2,2,4,4-tetramethylcyclobutyl)carbamate;hydrochloride |
| InChIKey | XXMUGWXZBCRCDV-UHFFFAOYSA-N |
| SMILES | CC1(C(C(C1NC(=O)OC(C)(C)C)(C)C)N)C.Cl |
Computed by PubChem (NCBI)