Products 2137886-64-5
CAS 2137886-64-5 appears in our catalog under these names: 5-Oxo-5,6,7,8-tetrahydroquinoline-3-carboxylic acid hydrochloride, 5-oxo-5,6,7,8-tetrahydroquinoline-3-carboxylic acid hydrochloride, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 5g, 0,5g, 250mg, 100mg, 1g.
5-oxo-7,8-dihydro-6H-quinoline-3-carboxylic acid;hydrochloride (CAS 2137886-64-5) is a chemical compound with the molecular formula C10H10ClNO3 and a molecular weight of 227.64 g/mol. IUPAC name: 5-oxo-7,8-dihydro-6H-quinoline-3-carboxylic acid;hydrochloride. InChIKey: WXPLKMHKPXLQFJ-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNO3 |
|---|---|
| Molecular weight | 227.64 g/mol |
| IUPAC name | 5-oxo-7,8-dihydro-6H-quinoline-3-carboxylic acid;hydrochloride |
| InChIKey | WXPLKMHKPXLQFJ-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=C(C=N2)C(=O)O)C(=O)C1.Cl |
Computed by PubChem (NCBI)