Products 2137970-61-5
CAS 2137970-61-5 is the registry number for rac-tert-Butyl (3aR,6aS)-1-oxo-octahydropyrrolo(3,4-c)pyrrole-2-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl (3aR,6aS)-4-oxo-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate (CAS 2137970-61-5) is a chemical compound with the molecular formula C11H18N2O3 and a molecular weight of 226.27 g/mol. IUPAC name: tert-butyl (3aR,6aS)-4-oxo-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate. InChIKey: ZCPQWXSMXZWYEK-YUMQZZPRSA-N.
| Molecular formula | C11H18N2O3 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | tert-butyl (3aR,6aS)-4-oxo-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
| InChIKey | ZCPQWXSMXZWYEK-YUMQZZPRSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2CNC[C@@H]2C1=O |
Computed by PubChem (NCBI)