Products 2138047-64-8
CAS 2138047-64-8 is the registry number for 2,4-Bis({((furan-2-yl)methyl)amino})benzene-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,4-bis(furan-2-ylmethylamino)benzenesulfonamide (CAS 2138047-64-8) is a chemical compound with the molecular formula C16H17N3O4S and a molecular weight of 347.4 g/mol. IUPAC name: 2,4-bis(furan-2-ylmethylamino)benzenesulfonamide. InChIKey: OPQIQPDHRQCFRD-UHFFFAOYSA-N.
| Molecular formula | C16H17N3O4S |
|---|---|
| Molecular weight | 347.4 g/mol |
| IUPAC name | 2,4-bis(furan-2-ylmethylamino)benzenesulfonamide |
| InChIKey | OPQIQPDHRQCFRD-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)CNC2=CC(=C(C=C2)S(=O)(=O)N)NCC3=CC=CO3 |
Computed by PubChem (NCBI)