CAS 2138055-83-9 is the registry number for Methyl 3-bromo-4-(carbamothioylamino)benzoate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Methyl 3-bromo-4-(carbamothioylamino)benzoate (CAS 2138055-83-9) is a chemical compound with the molecular formula C9H9BrN2O2S and a molecular weight of 289.15 g/mol. IUPAC name: methyl 3-bromo-4-(carbamothioylamino)benzoate. InChIKey: DVPJPJHHEBINFG-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2O2S |
|---|---|
| Molecular weight | 289.15 g/mol |
| IUPAC name | methyl 3-bromo-4-(carbamothioylamino)benzoate |
| InChIKey | DVPJPJHHEBINFG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)NC(=S)N)Br |
Computed by PubChem (NCBI)