Products 2138055-83-9

CAS 2138055-83-9 is the registry number for Methyl 3-bromo-4-(carbamothioylamino)benzoate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

Methyl 3-bromo-4-(carbamothioylamino)benzoate (CAS 2138055-83-9) is a chemical compound with the molecular formula C9H9BrN2O2S and a molecular weight of 289.15 g/mol. IUPAC name: methyl 3-bromo-4-(carbamothioylamino)benzoate. InChIKey: DVPJPJHHEBINFG-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9BrN2O2S
Molecular weight289.15 g/mol
IUPAC namemethyl 3-bromo-4-(carbamothioylamino)benzoate
InChIKeyDVPJPJHHEBINFG-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC(=C(C=C1)NC(=S)N)Br

Computed by PubChem (NCBI)