Products 88399-80-8

CAS 88399-80-8 is the registry number for Ethyl 5-amino-3-(bromomethyl)-4-cyanothiophene-2-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Ethyl 5-amino-3-(bromomethyl)-4-cyanothiophene-2-carboxylate (CAS 88399-80-8) is a chemical compound with the molecular formula C9H9BrN2O2S and a molecular weight of 289.15 g/mol. IUPAC name: ethyl 5-amino-3-(bromomethyl)-4-cyanothiophene-2-carboxylate. InChIKey: HRHLZMXUTKCAEU-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9BrN2O2S
Molecular weight289.15 g/mol
IUPAC nameethyl 5-amino-3-(bromomethyl)-4-cyanothiophene-2-carboxylate
InChIKeyHRHLZMXUTKCAEU-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(C(=C(S1)N)C#N)CBr

Computed by PubChem (NCBI)