CAS 2138100-50-0 is the registry number for 2-Methyl-2-(4-(pyrazin-2-yl)-1H-1,2,3-triazol-1-yl)propanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-methyl-2-(4-pyrazin-2-yltriazol-1-yl)propanoic acid (CAS 2138100-50-0) is a chemical compound with the molecular formula C10H11N5O2 and a molecular weight of 233.23 g/mol. IUPAC name: 2-methyl-2-(4-pyrazin-2-yltriazol-1-yl)propanoic acid. InChIKey: UOAABIIPOLKPLR-UHFFFAOYSA-N.
| Molecular formula | C10H11N5O2 |
|---|---|
| Molecular weight | 233.23 g/mol |
| IUPAC name | 2-methyl-2-(4-pyrazin-2-yltriazol-1-yl)propanoic acid |
| InChIKey | UOAABIIPOLKPLR-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)N1C=C(N=N1)C2=NC=CN=C2 |
Computed by PubChem (NCBI)