Products 213833-34-2
CAS 213833-34-2 appears in our catalog under these names: Zedoarofuran, Zedoarofuran, ≥98%. Offered by: GLPBio, Biosynth, MedChemExpress, Chemat. Available pack sizes: 5mg, 25mg, 10mg, 50mg, 5 mg, 1 mg.
(4aS,5R,8S,8aS)-5,8-dihydroxy-3,5,8a-trimethyl-6,7,8,9-tetrahydro-4aH-benzo[f][1]benzofuran-4-one (CAS 213833-34-2) is a chemical compound with the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. IUPAC name: (4aS,5R,8S,8aS)-5,8-dihydroxy-3,5,8a-trimethyl-6,7,8,9-tetrahydro-4aH-benzo[f][1]benzofuran-4-one. InChIKey: QXEXMTIZXNCRJO-BSLXNSKLSA-N.
| Molecular formula | C15H20O4 |
|---|---|
| Molecular weight | 264.32 g/mol |
| IUPAC name | (4aS,5R,8S,8aS)-5,8-dihydroxy-3,5,8a-trimethyl-6,7,8,9-tetrahydro-4aH-benzo[f][1]benzofuran-4-one |
| InChIKey | QXEXMTIZXNCRJO-BSLXNSKLSA-N |
| SMILES | CC1=COC2=C1C(=O)[C@@H]3[C@](CC[C@@H]([C@]3(C2)C)O)(C)O |
Computed by PubChem (NCBI)
Synonyms:
Zedoarofuran, orb1991432