Products 2138332-12-2
CAS 2138332-12-2 is the registry number for tert-Butyl 2-amino-3-cyano-5,6,7,8-tetrahydro-1,6-naphthyridine-6-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl 2-amino-3-cyano-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate (CAS 2138332-12-2) is a chemical compound with the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. IUPAC name: tert-butyl 2-amino-3-cyano-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate. InChIKey: UWRXOVWUDLTGGI-UHFFFAOYSA-N.
| Molecular formula | C14H18N4O2 |
|---|---|
| Molecular weight | 274.32 g/mol |
| IUPAC name | tert-butyl 2-amino-3-cyano-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate |
| InChIKey | UWRXOVWUDLTGGI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=NC(=C(C=C2C1)C#N)N |
Computed by PubChem (NCBI)