Products 2138423-88-6
CAS 2138423-88-6 is the registry number for tert-Butyl 6-amino-5-cyano-1,2,3,4-tetrahydro-2,7-naphthyridine-2-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl 6-amino-5-cyano-3,4-dihydro-1H-2,7-naphthyridine-2-carboxylate (CAS 2138423-88-6) is a chemical compound with the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. IUPAC name: tert-butyl 6-amino-5-cyano-3,4-dihydro-1H-2,7-naphthyridine-2-carboxylate. InChIKey: OIQZSEMFTQYABK-UHFFFAOYSA-N.
| Molecular formula | C14H18N4O2 |
|---|---|
| Molecular weight | 274.32 g/mol |
| IUPAC name | tert-butyl 6-amino-5-cyano-3,4-dihydro-1H-2,7-naphthyridine-2-carboxylate |
| InChIKey | OIQZSEMFTQYABK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C(=NC=C2C1)N)C#N |
Computed by PubChem (NCBI)