Products 2138574-75-9

CAS 2138574-75-9 is the registry number for 3-(4-Isopropylpiperazin-1-yl)cyclobutane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-(4-propan-2-ylpiperazin-1-yl)cyclobutane-1-carboxylic acid (CAS 2138574-75-9) is a chemical compound with the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. IUPAC name: 3-(4-propan-2-ylpiperazin-1-yl)cyclobutane-1-carboxylic acid. InChIKey: HXRAMZHKPFTMPV-UHFFFAOYSA-N.

Identity
Molecular formulaC12H22N2O2
Molecular weight226.32 g/mol
IUPAC name3-(4-propan-2-ylpiperazin-1-yl)cyclobutane-1-carboxylic acid
InChIKeyHXRAMZHKPFTMPV-UHFFFAOYSA-N
SMILESCC(C)N1CCN(CC1)C2CC(C2)C(=O)O

Computed by PubChem (NCBI)