CAS 2142-06-5 appears in our catalog under these names: 1–Benzylpyrrolidine–2,5–dione, 1-Benzylpyrrolidine-2,5-dione, 97%, 97%, 1-Benzylpyrrolidine-2,5-dione, 97%. Offered by: GLPBio, Chemat, Ambeed. Available pack sizes: 10g, 5g, 1g, 25g, 100g, 250mg.
1-benzylpyrrolidine-2,5-dione (CAS 2142-06-5) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: 1-benzylpyrrolidine-2,5-dione. InChIKey: IONNJVQITCVNHK-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 1-benzylpyrrolidine-2,5-dione |
| InChIKey | IONNJVQITCVNHK-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)