Products 21426-90-4
CAS 21426-90-4 is the registry number for 4-(Methoxycarbonyl)-1-naphthoic acid, 98%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g.
4-methoxycarbonylnaphthalene-1-carboxylic acid (CAS 21426-90-4) is a chemical compound with the molecular formula C13H10O4 and a molecular weight of 230.22 g/mol. IUPAC name: 4-methoxycarbonylnaphthalene-1-carboxylic acid. InChIKey: GIDDWUIWEVRLPQ-UHFFFAOYSA-N.
| Molecular formula | C13H10O4 |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | 4-methoxycarbonylnaphthalene-1-carboxylic acid |
| InChIKey | GIDDWUIWEVRLPQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C2=CC=CC=C21)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-(methoxycarbonyl)naphthalene-1-carboxylic acid, 4-(methoxycarbonyl)-1-naphthoic acid, Afoxolaner impurity 7, 4-(methoxycarbonyl)naphthalene-1-carboxylicacid, 4-methoxycarbonylnaphthalene-1-carboxylic acid, Naphthalene-1,4-dicarboxylic acid monomethyl ester, afoxolaner-003, methyl 1,4-napthalene monocarboxylate, GIDDWUIWEVRLPQ-UHFFFAOYSA-N, 1,4-Naphthalenedicarboxylic acid, 1-methyl ester