CAS 21434-14-0 is the registry number for 1-Phenyl-1H-1,2,4-triazole-3-thiol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-phenyl-1H-1,2,4-triazole-5-thione (CAS 21434-14-0) is a chemical compound with the molecular formula C8H7N3S and a molecular weight of 177.23 g/mol. IUPAC name: 2-phenyl-1H-1,2,4-triazole-5-thione. InChIKey: OJTPBFMSYXRIJE-UHFFFAOYSA-N.
| Molecular formula | C8H7N3S |
|---|---|
| Molecular weight | 177.23 g/mol |
| IUPAC name | 2-phenyl-1H-1,2,4-triazole-5-thione |
| InChIKey | OJTPBFMSYXRIJE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=NC(=S)N2 |
Computed by PubChem (NCBI)