Products 2143936-83-6
CAS 2143936-83-6 is the registry number for Fipsomin. Offered by: MedChemExpress. Available pack sizes: Get quote.
7,8-dihydroxy-6-(3-methylbut-2-enyl)chromen-2-one (CAS 2143936-83-6) is a chemical compound with the molecular formula C14H14O4 and a molecular weight of 246.26 g/mol. IUPAC name: 7,8-dihydroxy-6-(3-methylbut-2-enyl)chromen-2-one. InChIKey: QUTGZOYCLXJMNK-UHFFFAOYSA-N.
| Molecular formula | C14H14O4 |
|---|---|
| Molecular weight | 246.26 g/mol |
| IUPAC name | 7,8-dihydroxy-6-(3-methylbut-2-enyl)chromen-2-one |
| InChIKey | QUTGZOYCLXJMNK-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C(C(=C2C(=C1)C=CC(=O)O2)O)O)C |
Computed by PubChem (NCBI)
Synonyms:
Fipsomin, orb1942367