Products 21443-84-5

CAS 21443-84-5 is the registry number for Ethyl 4-nitro-1-phenyl-1H-pyrazole-3-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Ethyl 4-nitro-1-phenylpyrazole-3-carboxylate (CAS 21443-84-5) is a chemical compound with the molecular formula C12H11N3O4 and a molecular weight of 261.23 g/mol. IUPAC name: ethyl 4-nitro-1-phenylpyrazole-3-carboxylate. InChIKey: XVSPQFYKRDVSSR-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11N3O4
Molecular weight261.23 g/mol
IUPAC nameethyl 4-nitro-1-phenylpyrazole-3-carboxylate
InChIKeyXVSPQFYKRDVSSR-UHFFFAOYSA-N
SMILESCCOC(=O)C1=NN(C=C1[N+](=O)[O-])C2=CC=CC=C2

Computed by PubChem (NCBI)