CAS 21443-84-5 is the registry number for Ethyl 4-nitro-1-phenyl-1H-pyrazole-3-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Ethyl 4-nitro-1-phenylpyrazole-3-carboxylate (CAS 21443-84-5) is a chemical compound with the molecular formula C12H11N3O4 and a molecular weight of 261.23 g/mol. IUPAC name: ethyl 4-nitro-1-phenylpyrazole-3-carboxylate. InChIKey: XVSPQFYKRDVSSR-UHFFFAOYSA-N.
| Molecular formula | C12H11N3O4 |
|---|---|
| Molecular weight | 261.23 g/mol |
| IUPAC name | ethyl 4-nitro-1-phenylpyrazole-3-carboxylate |
| InChIKey | XVSPQFYKRDVSSR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NN(C=C1[N+](=O)[O-])C2=CC=CC=C2 |
Computed by PubChem (NCBI)