Products 21460-88-8

CAS 21460-88-8 appears in our catalog under these names: 2,5-Dichloro-4-methylbenzoic acid, 95%, 2,5-Dichloro-4-methylbenzoic acid 97%, 2,5-Dichloro-4-methylbenzoic acid, 97%, 97%, 2,5-DICHLORO-4-METHYLBENZOIC ACID, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 10g.

Structural formula: {0} (CAS {1})

2,5-dichloro-4-methylbenzoic acid (CAS 21460-88-8) is a chemical compound with the molecular formula C8H6Cl2O2 and a molecular weight of 205.03 g/mol. IUPAC name: 2,5-dichloro-4-methylbenzoic acid. InChIKey: KZEKKSQWQXNSBB-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6Cl2O2
Molecular weight205.03 g/mol
IUPAC name2,5-dichloro-4-methylbenzoic acid
InChIKeyKZEKKSQWQXNSBB-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1Cl)C(=O)O)Cl

Computed by PubChem (NCBI)