Products 2146079-62-9
CAS 2146079-62-9 is the registry number for 1-(4-(Benzyloxy)phenyl)-6-oxo-1,4,5,6-tetrahydropyridazine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6-oxo-1-(4-phenylmethoxyphenyl)-4,5-dihydropyridazine-3-carboxylic acid (CAS 2146079-62-9) is a chemical compound with the molecular formula C18H16N2O4 and a molecular weight of 324.3 g/mol. IUPAC name: 6-oxo-1-(4-phenylmethoxyphenyl)-4,5-dihydropyridazine-3-carboxylic acid. InChIKey: NERXQFIXOGBUAF-UHFFFAOYSA-N.
| Molecular formula | C18H16N2O4 |
|---|---|
| Molecular weight | 324.3 g/mol |
| IUPAC name | 6-oxo-1-(4-phenylmethoxyphenyl)-4,5-dihydropyridazine-3-carboxylic acid |
| InChIKey | NERXQFIXOGBUAF-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(N=C1C(=O)O)C2=CC=C(C=C2)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)