Products 214701-33-4
CAS 214701-33-4 is the registry number for 5-Bromo-2-(2-methyl-1,3-dioxolan-2-yl)pyridine, ≥95%. Offered by: Fluorochem. Available pack sizes: 1g.
5-bromo-2-(2-methyl-1,3-dioxolan-2-yl)pyridine (CAS 214701-33-4) is a chemical compound with the molecular formula C9H10BrNO2 and a molecular weight of 244.08 g/mol. IUPAC name: 5-bromo-2-(2-methyl-1,3-dioxolan-2-yl)pyridine. InChIKey: WVUQSFOCAUQIMM-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO2 |
|---|---|
| Molecular weight | 244.08 g/mol |
| IUPAC name | 5-bromo-2-(2-methyl-1,3-dioxolan-2-yl)pyridine |
| InChIKey | WVUQSFOCAUQIMM-UHFFFAOYSA-N |
| SMILES | CC1(OCCO1)C2=NC=C(C=C2)Br |
Computed by PubChem (NCBI)