CAS 214709-71-4 appears in our catalog under these names: N-Methyl-n-phenylalanine, 95%, N-Methyl-N-phenylalanine, 98%, 98%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 100mg.
2-(N-methylanilino)propanoic acid (CAS 214709-71-4) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: 2-(N-methylanilino)propanoic acid. InChIKey: BEIMQZCXRUNTAS-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | 2-(N-methylanilino)propanoic acid |
| InChIKey | BEIMQZCXRUNTAS-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)N(C)C1=CC=CC=C1 |
Computed by PubChem (NCBI)