Products 2151011-97-9
CAS 2151011-97-9 is the registry number for Methyl 5-bromo-6-cyclopropoxynicotinate, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg.
Methyl 5-bromo-6-cyclopropyloxypyridine-3-carboxylate (CAS 2151011-97-9) is a chemical compound with the molecular formula C10H10BrNO3 and a molecular weight of 272.09 g/mol. IUPAC name: methyl 5-bromo-6-cyclopropyloxypyridine-3-carboxylate. InChIKey: VGDWATXFFSLNDK-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO3 |
|---|---|
| Molecular weight | 272.09 g/mol |
| IUPAC name | methyl 5-bromo-6-cyclopropyloxypyridine-3-carboxylate |
| InChIKey | VGDWATXFFSLNDK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(N=C1)OC2CC2)Br |
Computed by PubChem (NCBI)